CAS 939043-53-5 is the registry number for 5,6-Difluoro-3,4-dihydronaphthalen-1(2h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
5,6-difluoro-3,4-dihydro-2H-naphthalen-1-one (CAS 939043-53-5) is a chemical compound with the molecular formula C10H8F2O and a molecular weight of 182.17 g/mol. IUPAC name: 5,6-difluoro-3,4-dihydro-2H-naphthalen-1-one. InChIKey: UXDWDQPKIDXBGD-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 5,6-difluoro-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | UXDWDQPKIDXBGD-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2F)F)C(=O)C1 |
Computed by PubChem (NCBI)