CAS 1094402-62-6 appears in our catalog under these names: 4-(4-(Chloromethyl)-1,3-thiazol-2-yl)benzamide, 95%, 4-(4-(Chloromethyl)-1,3-thiazol-2-yl)benzamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
4-[4-(chloromethyl)-1,3-thiazol-2-yl]benzamide (CAS 1094402-62-6) is a chemical compound with the molecular formula C11H9ClN2OS and a molecular weight of 252.72 g/mol. IUPAC name: 4-[4-(chloromethyl)-1,3-thiazol-2-yl]benzamide. InChIKey: LUEUJGNAZUAVDV-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2OS |
|---|---|
| Molecular weight | 252.72 g/mol |
| IUPAC name | 4-[4-(chloromethyl)-1,3-thiazol-2-yl]benzamide |
| InChIKey | LUEUJGNAZUAVDV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CS2)CCl)C(=O)N |
Computed by PubChem (NCBI)