CAS 61019-23-6 is the registry number for 2-Amino-4-(4-chlorophenyl)thiophene-3-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
2-amino-4-(4-chlorophenyl)thiophene-3-carboxamide (CAS 61019-23-6) is a chemical compound with the molecular formula C11H9ClN2OS and a molecular weight of 252.72 g/mol. IUPAC name: 2-amino-4-(4-chlorophenyl)thiophene-3-carboxamide. InChIKey: LCFOOVGQEWZAJK-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2OS |
|---|---|
| Molecular weight | 252.72 g/mol |
| IUPAC name | 2-amino-4-(4-chlorophenyl)thiophene-3-carboxamide |
| InChIKey | LCFOOVGQEWZAJK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC(=C2C(=O)N)N)Cl |
Computed by PubChem (NCBI)