CAS 1251200-68-6 is the registry number for 2-(5-Chlorothiophen-2-yl)-3H,4H,5H,6H,7H-cyclopenta(d)pyrimidin-4-one, 98%. Offered by: AmBeed. Available pack sizes: 1g.
2-(5-chlorothiophen-2-yl)-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one (CAS 1251200-68-6) is a chemical compound with the molecular formula C11H9ClN2OS and a molecular weight of 252.72 g/mol. IUPAC name: 2-(5-chlorothiophen-2-yl)-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one. InChIKey: WERRMRZADWOONZ-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2OS |
|---|---|
| Molecular weight | 252.72 g/mol |
| IUPAC name | 2-(5-chlorothiophen-2-yl)-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one |
| InChIKey | WERRMRZADWOONZ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)N=C(NC2=O)C3=CC=C(S3)Cl |
Computed by PubChem (NCBI)