CAS 2168133-87-5 is the registry number for 4-Chloro-6-(3,6-dihydro-2H-pyran-4-yl)thieno[3,2-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-6-(3,6-dihydro-2H-pyran-4-yl)thieno[3,2-d]pyrimidine (CAS 2168133-87-5) is a chemical compound with the molecular formula C11H9ClN2OS and a molecular weight of 252.72 g/mol. IUPAC name: 4-chloro-6-(3,6-dihydro-2H-pyran-4-yl)thieno[3,2-d]pyrimidine. InChIKey: LIKFHZUOVMONQQ-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2OS |
|---|---|
| Molecular weight | 252.72 g/mol |
| IUPAC name | 4-chloro-6-(3,6-dihydro-2H-pyran-4-yl)thieno[3,2-d]pyrimidine |
| InChIKey | LIKFHZUOVMONQQ-UHFFFAOYSA-N |
| SMILES | C1COCC=C1C2=CC3=C(S2)C(=NC=N3)Cl |
Computed by PubChem (NCBI)