CAS 175137-05-0 appears in our catalog under these names: 3-Amino-5-(4-chlorophenyl)thiophene-2-carboxamide, 95+%, 3-Amino-5-(4-chlorophenyl)thiophene-2-carboxamide. Offered by: AmBeed, Fluorochem. Available pack sizes: 25g, 250mg, 1g, 5g.
3-amino-5-(4-chlorophenyl)thiophene-2-carboxamide (CAS 175137-05-0) is a chemical compound with the molecular formula C11H9ClN2OS and a molecular weight of 252.72 g/mol. IUPAC name: 3-amino-5-(4-chlorophenyl)thiophene-2-carboxamide. InChIKey: MQYJPACEBWKWEH-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2OS |
|---|---|
| Molecular weight | 252.72 g/mol |
| IUPAC name | 3-amino-5-(4-chlorophenyl)thiophene-2-carboxamide |
| InChIKey | MQYJPACEBWKWEH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(S2)C(=O)N)N)Cl |
Computed by PubChem (NCBI)