Products 1147335-76-9
CAS 1147335-76-9 is the registry number for 2-((3-Chloropyridin-2-yl)thio)-1-(1H-pyrrol-2-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3-chloro-2-pyridinyl)sulfanyl]-1-(1H-pyrrol-2-yl)ethanone (CAS 1147335-76-9) is a chemical compound with the molecular formula C11H9ClN2OS and a molecular weight of 252.72 g/mol. IUPAC name: 2-[(3-chloro-2-pyridinyl)sulfanyl]-1-(1H-pyrrol-2-yl)ethanone. InChIKey: ZKNWRINWHKHTME-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2OS |
|---|---|
| Molecular weight | 252.72 g/mol |
| IUPAC name | 2-[(3-chloro-2-pyridinyl)sulfanyl]-1-(1H-pyrrol-2-yl)ethanone |
| InChIKey | ZKNWRINWHKHTME-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)SCC(=O)C2=CC=CN2)Cl |
Computed by PubChem (NCBI)