Products 1094424-70-0
CAS 1094424-70-0 is the registry number for 8-Nitro-3,4-dihydro-2H-1,5-benzodioxepine-7-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
7-nitro-3,4-dihydro-2H-1,5-benzodioxepine-8-carboxylic acid (CAS 1094424-70-0) is a chemical compound with the molecular formula C10H9NO6 and a molecular weight of 239.18 g/mol. IUPAC name: 7-nitro-3,4-dihydro-2H-1,5-benzodioxepine-8-carboxylic acid. InChIKey: WJJGEOWHQUZVBK-UHFFFAOYSA-N.
| Molecular formula | C10H9NO6 |
|---|---|
| Molecular weight | 239.18 g/mol |
| IUPAC name | 7-nitro-3,4-dihydro-2H-1,5-benzodioxepine-8-carboxylic acid |
| InChIKey | WJJGEOWHQUZVBK-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C(=C2)C(=O)O)[N+](=O)[O-])OC1 |
Computed by PubChem (NCBI)