Products 1094456-17-3
CAS 1094456-17-3 is the registry number for [2-(2-Bromophenyl)-1,3-thiazol-4-yl]acetic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-[2-(2-bromophenyl)-1,3-thiazol-4-yl]acetic acid (CAS 1094456-17-3) is a chemical compound with the molecular formula C11H8BrNO2S and a molecular weight of 298.16 g/mol. IUPAC name: 2-[2-(2-bromophenyl)-1,3-thiazol-4-yl]acetic acid. InChIKey: DHHVQRALNUQHBU-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO2S |
|---|---|
| Molecular weight | 298.16 g/mol |
| IUPAC name | 2-[2-(2-bromophenyl)-1,3-thiazol-4-yl]acetic acid |
| InChIKey | DHHVQRALNUQHBU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=CS2)CC(=O)O)Br |
Computed by PubChem (NCBI)