CAS 1208081-39-3 is the registry number for Methyl 2-(4-bromophenyl)thiazole-4-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
Methyl 2-(4-bromophenyl)-1,3-thiazole-4-carboxylate (CAS 1208081-39-3) is a chemical compound with the molecular formula C11H8BrNO2S and a molecular weight of 298.16 g/mol. IUPAC name: methyl 2-(4-bromophenyl)-1,3-thiazole-4-carboxylate. InChIKey: PJHIWUICMRXOAE-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO2S |
|---|---|
| Molecular weight | 298.16 g/mol |
| IUPAC name | methyl 2-(4-bromophenyl)-1,3-thiazole-4-carboxylate |
| InChIKey | PJHIWUICMRXOAE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CSC(=N1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)