Products 1527613-25-7

CAS 1527613-25-7 is the registry number for 2-(5-Bromo-2-methylphenyl)thiazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(5-bromo-2-methylphenyl)-1,3-thiazole-4-carboxylic acid (CAS 1527613-25-7) is a chemical compound with the molecular formula C11H8BrNO2S and a molecular weight of 298.16 g/mol. IUPAC name: 2-(5-bromo-2-methylphenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: ZHKQIDQEGYZNMZ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8BrNO2S
Molecular weight298.16 g/mol
IUPAC name2-(5-bromo-2-methylphenyl)-1,3-thiazole-4-carboxylic acid
InChIKeyZHKQIDQEGYZNMZ-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)Br)C2=NC(=CS2)C(=O)O

Computed by PubChem (NCBI)