CAS 1188051-57-1 is the registry number for 4-(4-Bromophenyl)-2-methyl-1,3-thiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(4-bromophenyl)-2-methyl-1,3-thiazole-5-carboxylic acid (CAS 1188051-57-1) is a chemical compound with the molecular formula C11H8BrNO2S and a molecular weight of 298.16 g/mol. IUPAC name: 4-(4-bromophenyl)-2-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: SDCYEXCIKYWMEP-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO2S |
|---|---|
| Molecular weight | 298.16 g/mol |
| IUPAC name | 4-(4-bromophenyl)-2-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | SDCYEXCIKYWMEP-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(S1)C(=O)O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)