Products 58765-86-9
CAS 58765-86-9 is the registry number for 2-(4-Bromophenyl)-4-methylthiazole-5-carboxylic acid, 98%. Offered by: Fluorochem. Available pack sizes: 1g.
2-(4-bromophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 58765-86-9) is a chemical compound with the molecular formula C11H8BrNO2S and a molecular weight of 298.16 g/mol. IUPAC name: 2-(4-bromophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: PMEDEHFPUQRZJW-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO2S |
|---|---|
| Molecular weight | 298.16 g/mol |
| IUPAC name | 2-(4-bromophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | PMEDEHFPUQRZJW-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)