Products 1360437-87-1
CAS 1360437-87-1 is the registry number for Methyl 2-(3-bromophenyl)thiazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS 1360437-87-1) is a chemical compound with the molecular formula C11H8BrNO2S and a molecular weight of 298.16 g/mol. IUPAC name: methyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate. InChIKey: NJELTUQATPKHOO-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO2S |
|---|---|
| Molecular weight | 298.16 g/mol |
| IUPAC name | methyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate |
| InChIKey | NJELTUQATPKHOO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CSC(=N1)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)