CAS 1094477-09-4 appears in our catalog under these names: 2-Chloro-6-(2,3,6-trimethylphenoxy)benzaldehyde, 95%, 2-Chloro-6-(2,3,6-trimethylphenoxy)benzaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-chloro-6-(2,3,6-trimethylphenoxy)benzaldehyde (CAS 1094477-09-4) is a chemical compound with the molecular formula C16H15ClO2 and a molecular weight of 274.74 g/mol. IUPAC name: 2-chloro-6-(2,3,6-trimethylphenoxy)benzaldehyde. InChIKey: MNXMXTVFYFHNIZ-UHFFFAOYSA-N.
| Molecular formula | C16H15ClO2 |
|---|---|
| Molecular weight | 274.74 g/mol |
| IUPAC name | 2-chloro-6-(2,3,6-trimethylphenoxy)benzaldehyde |
| InChIKey | MNXMXTVFYFHNIZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C)OC2=C(C(=CC=C2)Cl)C=O)C |
Computed by PubChem (NCBI)