Products 1094547-13-3
CAS 1094547-13-3 is the registry number for 4-Bromo-2-(2,2,2-trifluoroethoxy)benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-bromo-2-(2,2,2-trifluoroethoxy)benzoic acid (CAS 1094547-13-3) is a chemical compound with the molecular formula C9H6BrF3O3 and a molecular weight of 299.04 g/mol. IUPAC name: 4-bromo-2-(2,2,2-trifluoroethoxy)benzoic acid. InChIKey: LPGWGYFLNMBODX-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O3 |
|---|---|
| Molecular weight | 299.04 g/mol |
| IUPAC name | 4-bromo-2-(2,2,2-trifluoroethoxy)benzoic acid |
| InChIKey | LPGWGYFLNMBODX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)OCC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)