CAS 1094550-51-2 is the registry number for Methyl 3-(6-bromo-4-oxo-3,4-dihydroquinazolin-3-yl)propanoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 3-(6-bromo-4-oxoquinazolin-3-yl)propanoate (CAS 1094550-51-2) is a chemical compound with the molecular formula C12H11BrN2O3 and a molecular weight of 311.13 g/mol. IUPAC name: methyl 3-(6-bromo-4-oxoquinazolin-3-yl)propanoate. InChIKey: PRPYEJQPPVEXBJ-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN2O3 |
|---|---|
| Molecular weight | 311.13 g/mol |
| IUPAC name | methyl 3-(6-bromo-4-oxoquinazolin-3-yl)propanoate |
| InChIKey | PRPYEJQPPVEXBJ-UHFFFAOYSA-N |
| SMILES | COC(=O)CCN1C=NC2=C(C1=O)C=C(C=C2)Br |
Computed by PubChem (NCBI)