Products 1094550-51-2

CAS 1094550-51-2 is the registry number for Methyl 3-(6-bromo-4-oxo-3,4-dihydroquinazolin-3-yl)propanoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 3-(6-bromo-4-oxoquinazolin-3-yl)propanoate (CAS 1094550-51-2) is a chemical compound with the molecular formula C12H11BrN2O3 and a molecular weight of 311.13 g/mol. IUPAC name: methyl 3-(6-bromo-4-oxoquinazolin-3-yl)propanoate. InChIKey: PRPYEJQPPVEXBJ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11BrN2O3
Molecular weight311.13 g/mol
IUPAC namemethyl 3-(6-bromo-4-oxoquinazolin-3-yl)propanoate
InChIKeyPRPYEJQPPVEXBJ-UHFFFAOYSA-N
SMILESCOC(=O)CCN1C=NC2=C(C1=O)C=C(C=C2)Br

Computed by PubChem (NCBI)