Products 1095432-76-0
CAS 1095432-76-0 appears in our catalog under these names: 2-Formyl-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 95%, 95%, 2-Formyl-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-(4-carboxyphenyl)-3-formylbenzoic acid (CAS 1095432-76-0) is a chemical compound with the molecular formula C15H10O5 and a molecular weight of 270.24 g/mol. IUPAC name: 4-(4-carboxyphenyl)-3-formylbenzoic acid. InChIKey: XMGKDEXRUPGLHM-UHFFFAOYSA-N.
| Molecular formula | C15H10O5 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | 4-(4-carboxyphenyl)-3-formylbenzoic acid |
| InChIKey | XMGKDEXRUPGLHM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=C(C=C2)C(=O)O)C=O)C(=O)O |
Computed by PubChem (NCBI)