Products 1095588-70-7
CAS 1095588-70-7 appears in our catalog under these names: 10,11-Dehydrocurvularin, 10, 11-Dehydrocurvularin, 10,11-Dehydrocurvularin, 95.00%, (R)-10,11-Dehydrocurvularin. Offered by: TRC, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2,5mg, 5mg, 2mg, 5 mg, 2.5 mg, 1 mg.
(5S,9E)-13,15-dihydroxy-5-methyl-4-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraene-3,11-dione (CAS 1095588-70-7) is a chemical compound with the molecular formula C16H18O5 and a molecular weight of 290.31 g/mol. IUPAC name: (5S,9E)-13,15-dihydroxy-5-methyl-4-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraene-3,11-dione. InChIKey: AVIRMQMUBGNCKS-RWCYGVJQSA-N.
| Molecular formula | C16H18O5 |
|---|---|
| Molecular weight | 290.31 g/mol |
| IUPAC name | (5S,9E)-13,15-dihydroxy-5-methyl-4-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraene-3,11-dione |
| InChIKey | AVIRMQMUBGNCKS-RWCYGVJQSA-N |
| SMILES | C[C@H]1CCC/C=C/C(=O)C2=C(CC(=O)O1)C=C(C=C2O)O |
Computed by PubChem (NCBI)