Products 2188162-97-0
CAS 2188162-97-0 appears in our catalog under these names: 6–Hydroxycoumurrayin, 6-Hydroxycoumurrayin. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
6-hydroxy-5,7-dimethoxy-8-(3-methylbut-2-enyl)chromen-2-one (CAS 2188162-97-0) is a chemical compound with the molecular formula C16H18O5 and a molecular weight of 290.31 g/mol. IUPAC name: 6-hydroxy-5,7-dimethoxy-8-(3-methylbut-2-enyl)chromen-2-one. InChIKey: SBZHOADRHUVKKQ-UHFFFAOYSA-N.
| Molecular formula | C16H18O5 |
|---|---|
| Molecular weight | 290.31 g/mol |
| IUPAC name | 6-hydroxy-5,7-dimethoxy-8-(3-methylbut-2-enyl)chromen-2-one |
| InChIKey | SBZHOADRHUVKKQ-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C(=C(C2=C1OC(=O)C=C2)OC)O)OC)C |
Computed by PubChem (NCBI)