Products 1096257-79-2
CAS 1096257-79-2 is the registry number for 3-Chloro-4-(((3,5-dimethylisoxazol-4-yl)methyl)thio)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-4-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]aniline (CAS 1096257-79-2) is a chemical compound with the molecular formula C12H13ClN2OS and a molecular weight of 268.76 g/mol. IUPAC name: 3-chloro-4-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]aniline. InChIKey: GFBMXJHIKMONJX-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2OS |
|---|---|
| Molecular weight | 268.76 g/mol |
| IUPAC name | 3-chloro-4-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]aniline |
| InChIKey | GFBMXJHIKMONJX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)CSC2=C(C=C(C=C2)N)Cl |
Computed by PubChem (NCBI)