CAS 731001-91-5 appears in our catalog under these names: 4-[(Chloroacetyl)amino]-3-ethyl-5-methylphenyl thiocyanate, 95%, 2-Chloro-N-(4-(cyanosulfanyl)-2-ethyl-6-methylphenyl)acetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
[4-[(2-chloroacetyl)amino]-3-ethyl-5-methylphenyl] thiocyanate (CAS 731001-91-5) is a chemical compound with the molecular formula C12H13ClN2OS and a molecular weight of 268.76 g/mol. IUPAC name: [4-[(2-chloroacetyl)amino]-3-ethyl-5-methylphenyl] thiocyanate. InChIKey: ZDIFNNHLAFCJRG-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2OS |
|---|---|
| Molecular weight | 268.76 g/mol |
| IUPAC name | [4-[(2-chloroacetyl)amino]-3-ethyl-5-methylphenyl] thiocyanate |
| InChIKey | ZDIFNNHLAFCJRG-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=CC(=C1)SC#N)C)NC(=O)CCl |
Computed by PubChem (NCBI)