CAS 58125-41-0 is the registry number for 3-Chloro-n-(3-cyano-4,5,6,7-tetrahydro-1-benzothien-2-yl)propanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
3-chloro-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)propanamide (CAS 58125-41-0) is a chemical compound with the molecular formula C12H13ClN2OS and a molecular weight of 268.76 g/mol. IUPAC name: 3-chloro-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)propanamide. InChIKey: OIRKVPMIFKTKMO-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2OS |
|---|---|
| Molecular weight | 268.76 g/mol |
| IUPAC name | 3-chloro-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)propanamide |
| InChIKey | OIRKVPMIFKTKMO-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=C(S2)NC(=O)CCCl)C#N |
Computed by PubChem (NCBI)