CAS 1098361-16-0 appears in our catalog under these names: N-(1,3-Benzothiazol-2-ylmethyl)-2-chloro-N-methylpropanamide, 95%, N-(1,3-Benzothiazol-2-ylmethyl)-2-chloro-N-methylpropanamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
N-(1,3-benzothiazol-2-ylmethyl)-2-chloro-N-methylpropanamide (CAS 1098361-16-0) is a chemical compound with the molecular formula C12H13ClN2OS and a molecular weight of 268.76 g/mol. IUPAC name: N-(1,3-benzothiazol-2-ylmethyl)-2-chloro-N-methylpropanamide. InChIKey: XEDAOJOZFJRAIS-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2OS |
|---|---|
| Molecular weight | 268.76 g/mol |
| IUPAC name | N-(1,3-benzothiazol-2-ylmethyl)-2-chloro-N-methylpropanamide |
| InChIKey | XEDAOJOZFJRAIS-UHFFFAOYSA-N |
| SMILES | CC(C(=O)N(C)CC1=NC2=CC=CC=C2S1)Cl |
Computed by PubChem (NCBI)