CAS 847783-40-8 is the registry number for N-(1-(1,3-Benzothiazol-2-yl)ethyl)-2-chloro-N-methylacetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N-[1-(1,3-benzothiazol-2-yl)ethyl]-2-chloro-N-methylacetamide (CAS 847783-40-8) is a chemical compound with the molecular formula C12H13ClN2OS and a molecular weight of 268.76 g/mol. IUPAC name: N-[1-(1,3-benzothiazol-2-yl)ethyl]-2-chloro-N-methylacetamide. InChIKey: KCMXHYDEJVLZIK-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2OS |
|---|---|
| Molecular weight | 268.76 g/mol |
| IUPAC name | N-[1-(1,3-benzothiazol-2-yl)ethyl]-2-chloro-N-methylacetamide |
| InChIKey | KCMXHYDEJVLZIK-UHFFFAOYSA-N |
| SMILES | CC(C1=NC2=CC=CC=C2S1)N(C)C(=O)CCl |
Computed by PubChem (NCBI)