CAS 1481377-58-5 appears in our catalog under these names: {1-(1-(4-chlorophenyl)ethyl)-2-sulfanyl-1H-imidazol-5-yl}methanol, 95%, {1-(1-(4-Chlorophenyl)ethyl)-2-sulfanyl-1H-imidazol-5-yl}methanol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-[1-(4-chlorophenyl)ethyl]-4-(hydroxymethyl)-1H-imidazole-2-thione (CAS 1481377-58-5) is a chemical compound with the molecular formula C12H13ClN2OS and a molecular weight of 268.76 g/mol. IUPAC name: 3-[1-(4-chlorophenyl)ethyl]-4-(hydroxymethyl)-1H-imidazole-2-thione. InChIKey: VPYXUSJUBSGJJT-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2OS |
|---|---|
| Molecular weight | 268.76 g/mol |
| IUPAC name | 3-[1-(4-chlorophenyl)ethyl]-4-(hydroxymethyl)-1H-imidazole-2-thione |
| InChIKey | VPYXUSJUBSGJJT-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)Cl)N2C(=CNC2=S)CO |
Computed by PubChem (NCBI)