Products 1096842-91-9
CAS 1096842-91-9 appears in our catalog under these names: N-Cyclopropyl 4-bromo-3-nitrobenzamide, 97%, 4-Bromo-N-cyclopropyl-3-nitrobenzamide, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g.
4-bromo-N-cyclopropyl-3-nitrobenzamide (CAS 1096842-91-9) is a chemical compound with the molecular formula C10H9BrN2O3 and a molecular weight of 285.09 g/mol. IUPAC name: 4-bromo-N-cyclopropyl-3-nitrobenzamide. InChIKey: MLKWFRMOGRIXEW-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O3 |
|---|---|
| Molecular weight | 285.09 g/mol |
| IUPAC name | 4-bromo-N-cyclopropyl-3-nitrobenzamide |
| InChIKey | MLKWFRMOGRIXEW-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)C2=CC(=C(C=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)