CAS 2280862-14-6 is the registry number for 2-Bromo-6,7-dimethoxyquinazolin-4(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-6,7-dimethoxy-3H-quinazolin-4-one (CAS 2280862-14-6) is a chemical compound with the molecular formula C10H9BrN2O3 and a molecular weight of 285.09 g/mol. IUPAC name: 2-bromo-6,7-dimethoxy-3H-quinazolin-4-one. InChIKey: FQLUGIJASAMPRC-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O3 |
|---|---|
| Molecular weight | 285.09 g/mol |
| IUPAC name | 2-bromo-6,7-dimethoxy-3H-quinazolin-4-one |
| InChIKey | FQLUGIJASAMPRC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)NC(=N2)Br)OC |
Computed by PubChem (NCBI)