Products 1543258-72-5

CAS 1543258-72-5 is the registry number for 2-(6-Bromo-8-methoxyimidazo[1,2-a]pyridin-2-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(6-bromo-8-methoxyimidazo[1,2-a]pyridin-2-yl)acetic acid (CAS 1543258-72-5) is a chemical compound with the molecular formula C10H9BrN2O3 and a molecular weight of 285.09 g/mol. IUPAC name: 2-(6-bromo-8-methoxyimidazo[1,2-a]pyridin-2-yl)acetic acid. InChIKey: RQUIGZRKSQCXOS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9BrN2O3
Molecular weight285.09 g/mol
IUPAC name2-(6-bromo-8-methoxyimidazo[1,2-a]pyridin-2-yl)acetic acid
InChIKeyRQUIGZRKSQCXOS-UHFFFAOYSA-N
SMILESCOC1=CC(=CN2C1=NC(=C2)CC(=O)O)Br

Computed by PubChem (NCBI)