CAS 1692613-03-8 is the registry number for (3-(3-Bromo-4-methoxyphenyl)-1,2,4-oxadiazol-5-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[3-(3-bromo-4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methanol (CAS 1692613-03-8) is a chemical compound with the molecular formula C10H9BrN2O3 and a molecular weight of 285.09 g/mol. IUPAC name: [3-(3-bromo-4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methanol. InChIKey: JHAWMARSOGXLFS-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O3 |
|---|---|
| Molecular weight | 285.09 g/mol |
| IUPAC name | [3-(3-bromo-4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methanol |
| InChIKey | JHAWMARSOGXLFS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NOC(=N2)CO)Br |
Computed by PubChem (NCBI)