Products 1251582-89-4
CAS 1251582-89-4 is the registry number for Ethyl 3-amino-5-bromofuro[2,3-b]pyridine-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 3-amino-5-bromofuro[2,3-b]pyridine-2-carboxylate (CAS 1251582-89-4) is a chemical compound with the molecular formula C10H9BrN2O3 and a molecular weight of 285.09 g/mol. IUPAC name: ethyl 3-amino-5-bromofuro[2,3-b]pyridine-2-carboxylate. InChIKey: SXAYOEQEBXVSAE-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O3 |
|---|---|
| Molecular weight | 285.09 g/mol |
| IUPAC name | ethyl 3-amino-5-bromofuro[2,3-b]pyridine-2-carboxylate |
| InChIKey | SXAYOEQEBXVSAE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(O1)N=CC(=C2)Br)N |
Computed by PubChem (NCBI)