Products 804555-02-0
CAS 804555-02-0 appears in our catalog under these names: 3-Bromo-1-(3-nitrophenyl)pyrrolidin-2-one, 95%, 3-Bromo-1-(3-nitrophenyl)pyrrolidin-2-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3-bromo-1-(3-nitrophenyl)pyrrolidin-2-one (CAS 804555-02-0) is a chemical compound with the molecular formula C10H9BrN2O3 and a molecular weight of 285.09 g/mol. IUPAC name: 3-bromo-1-(3-nitrophenyl)pyrrolidin-2-one. InChIKey: OBBVAEDSNFSZGW-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O3 |
|---|---|
| Molecular weight | 285.09 g/mol |
| IUPAC name | 3-bromo-1-(3-nitrophenyl)pyrrolidin-2-one |
| InChIKey | OBBVAEDSNFSZGW-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)C1Br)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)