CAS 1096940-68-9 appears in our catalog under these names: 4-(2,4-Dimethylphenyl)-5-(pyridin-2-yl)-4h-1,2,4-triazole-3-thiol, 95%, 4-(2,4-Dimethylphenyl)-5-(pyridin-2-yl)-4H-1,2,4-triazole-3-thiol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
4-(2,4-dimethylphenyl)-3-pyridin-2-yl-1H-1,2,4-triazole-5-thione (CAS 1096940-68-9) is a chemical compound with the molecular formula C15H14N4S and a molecular weight of 282.4 g/mol. IUPAC name: 4-(2,4-dimethylphenyl)-3-pyridin-2-yl-1H-1,2,4-triazole-5-thione. InChIKey: KLMIZCJFWTYATK-UHFFFAOYSA-N.
| Molecular formula | C15H14N4S |
|---|---|
| Molecular weight | 282.4 g/mol |
| IUPAC name | 4-(2,4-dimethylphenyl)-3-pyridin-2-yl-1H-1,2,4-triazole-5-thione |
| InChIKey | KLMIZCJFWTYATK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2C(=NNC2=S)C3=CC=CC=N3)C |
Computed by PubChem (NCBI)