CAS 117080-37-2 is the registry number for 4-(3,4-Dimethylphenyl)-5-(pyridin-4-yl)-4H-1,2,4-triazole-3-thiol, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-(3,4-dimethylphenyl)-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione (CAS 117080-37-2) is a chemical compound with the molecular formula C15H14N4S and a molecular weight of 282.4 g/mol. IUPAC name: 4-(3,4-dimethylphenyl)-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione. InChIKey: QZFFLMOXIVIZTC-UHFFFAOYSA-N.
| Molecular formula | C15H14N4S |
|---|---|
| Molecular weight | 282.4 g/mol |
| IUPAC name | 4-(3,4-dimethylphenyl)-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione |
| InChIKey | QZFFLMOXIVIZTC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C(=NNC2=S)C3=CC=NC=C3)C |
Computed by PubChem (NCBI)