CAS 168910-32-5 is the registry number for 5-(4-Tolylthio)-2,4-diaminoquinazoline, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg.
5-(4-methylphenyl)sulfanylquinazoline-2,4-diamine (CAS 168910-32-5) is a chemical compound with the molecular formula C15H14N4S and a molecular weight of 282.4 g/mol. IUPAC name: 5-(4-methylphenyl)sulfanylquinazoline-2,4-diamine. InChIKey: UOJFGEAPSYQDIP-UHFFFAOYSA-N.
| Molecular formula | C15H14N4S |
|---|---|
| Molecular weight | 282.4 g/mol |
| IUPAC name | 5-(4-methylphenyl)sulfanylquinazoline-2,4-diamine |
| InChIKey | UOJFGEAPSYQDIP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)SC2=CC=CC3=C2C(=NC(=N3)N)N |
Computed by PubChem (NCBI)