CAS 660837-08-1 appears in our catalog under these names: 2-(2-Methyl-5-aminophenylamino)-4-(3-pyridyl)thiazole, 97%, 97%, 6-METHYL-N1-(4-(PYRIDIN-3-YL)THIAZOL-2-YL)BENZENE-1,3-DIAMINE, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-methyl-3-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzene-1,3-diamine (CAS 660837-08-1) is a chemical compound with the molecular formula C15H14N4S and a molecular weight of 282.4 g/mol. IUPAC name: 4-methyl-3-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzene-1,3-diamine. InChIKey: JKQOCRHWVAAVFB-UHFFFAOYSA-N.
| Molecular formula | C15H14N4S |
|---|---|
| Molecular weight | 282.4 g/mol |
| IUPAC name | 4-methyl-3-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzene-1,3-diamine |
| InChIKey | JKQOCRHWVAAVFB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N)NC2=NC(=CS2)C3=CN=CC=C3 |
Computed by PubChem (NCBI)