CAS 7612-98-8 appears in our catalog under these names: 4-(N,N-Dimethylamino)azobenzene-4'-isothiocyanate, 95%, 4-(Dimethylamino)azobenzene 4'-Isothiocyanate, >98.0%(HPLC), 4-(N,N-Dimethylamino)azobenzene-4'-isothiocyanate, 4-((4-Isothiocyanatophenyl)diazenyl)-N,N-dimethylaniline, 98.0%, 98.0%. Offered by: Combi-blocks, TCI, MedChemExpress, Chemat. Available pack sizes: 100mg, 1 g, 250 mg, 100 mg, 1g.
4-[(4-isothiocyanatophenyl)diazenyl]-N,N-dimethylaniline (CAS 7612-98-8) is a chemical compound with the molecular formula C15H14N4S and a molecular weight of 282.4 g/mol. IUPAC name: 4-[(4-isothiocyanatophenyl)diazenyl]-N,N-dimethylaniline. InChIKey: OSWZKAVBSQAVFI-UHFFFAOYSA-N.
| Molecular formula | C15H14N4S |
|---|---|
| Molecular weight | 282.4 g/mol |
| IUPAC name | 4-[(4-isothiocyanatophenyl)diazenyl]-N,N-dimethylaniline |
| InChIKey | OSWZKAVBSQAVFI-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)N=C=S |
Computed by PubChem (NCBI)