CAS 878671-96-6 appears in our catalog under these names: Lesinurad Impurity 12, 5–Amino–4–(4–cyclopropylnaphthalen–1–yl)–4H–1,2,4–triazole–3–thiol, 3-Amino-4-(4-cyclopropylnaphthalen-1-yl)-4H-1,2,4-triazole-5-thiol, 99%, 99%. Offered by: Chemat Brand, GLPBio, Chemat. Available pack sizes: on request, 1g, 250mg, 50mg.
3-amino-4-(4-cyclopropylnaphthalen-1-yl)-1H-1,2,4-triazole-5-thione (CAS 878671-96-6) is a chemical compound with the molecular formula C15H14N4S and a molecular weight of 282.4 g/mol. IUPAC name: 3-amino-4-(4-cyclopropylnaphthalen-1-yl)-1H-1,2,4-triazole-5-thione. InChIKey: VHPOGQZYQNLNNN-UHFFFAOYSA-N.
| Molecular formula | C15H14N4S |
|---|---|
| Molecular weight | 282.4 g/mol |
| IUPAC name | 3-amino-4-(4-cyclopropylnaphthalen-1-yl)-1H-1,2,4-triazole-5-thione |
| InChIKey | VHPOGQZYQNLNNN-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC=C(C3=CC=CC=C23)N4C(=NNC4=S)N |
Computed by PubChem (NCBI)