CAS 1096943-94-0 is the registry number for 1-{4H,5H,6H,7H-Thieno(3,2-c)pyridine-5-carbonyl}piperidine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)piperidine-3-carboxylic acid (CAS 1096943-94-0) is a chemical compound with the molecular formula C14H18N2O3S and a molecular weight of 294.37 g/mol. IUPAC name: 1-(6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)piperidine-3-carboxylic acid. InChIKey: JXYLDVDKOKIPOS-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O3S |
|---|---|
| Molecular weight | 294.37 g/mol |
| IUPAC name | 1-(6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)piperidine-3-carboxylic acid |
| InChIKey | JXYLDVDKOKIPOS-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)N2CCC3=C(C2)C=CS3)C(=O)O |
Computed by PubChem (NCBI)