CAS 112306-61-3 appears in our catalog under these names: Benzylhydrazine 4-methylbenzenesulfonate, 95%+, 95%+, Benzylhydrazine 4-methylbenzenesulfonate, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 5g, 100mg.
Benzylhydrazine;4-methylbenzenesulfonic acid (CAS 112306-61-3) is a chemical compound with the molecular formula C14H18N2O3S and a molecular weight of 294.37 g/mol. IUPAC name: benzylhydrazine;4-methylbenzenesulfonic acid. InChIKey: WESZKALUZBIEAG-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O3S |
|---|---|
| Molecular weight | 294.37 g/mol |
| IUPAC name | benzylhydrazine;4-methylbenzenesulfonic acid |
| InChIKey | WESZKALUZBIEAG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1=CC=C(C=C1)CNN |
Computed by PubChem (NCBI)