Products 1978428-24-8
CAS 1978428-24-8 is the registry number for 3-((4,5,6,7-Tetrahydrobenzo[d]thiazol-2-yl)carbamoyl)cyclopentane-1-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylcarbamoyl)cyclopentane-1-carboxylic acid (CAS 1978428-24-8) is a chemical compound with the molecular formula C14H18N2O3S and a molecular weight of 294.37 g/mol. IUPAC name: 3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylcarbamoyl)cyclopentane-1-carboxylic acid. InChIKey: VXZFGCQCLBZZJE-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O3S |
|---|---|
| Molecular weight | 294.37 g/mol |
| IUPAC name | 3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylcarbamoyl)cyclopentane-1-carboxylic acid |
| InChIKey | VXZFGCQCLBZZJE-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)N=C(S2)NC(=O)C3CCC(C3)C(=O)O |
Computed by PubChem (NCBI)