Products 1351448-98-0
CAS 1351448-98-0 is the registry number for 3-Piperidinecarboxamide, 1-[1,4-dioxo-4-(2-thienyl)butyl]-, (3S)-, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 5mg, 25mg, 100mg.
1-(4-oxo-4-thiophen-2-ylbutanoyl)piperidine-3-carboxamide (CAS 1351448-98-0) is a chemical compound with the molecular formula C14H18N2O3S and a molecular weight of 294.37 g/mol. IUPAC name: 1-(4-oxo-4-thiophen-2-ylbutanoyl)piperidine-3-carboxamide. InChIKey: AGHXEEQYYLOXNF-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O3S |
|---|---|
| Molecular weight | 294.37 g/mol |
| IUPAC name | 1-(4-oxo-4-thiophen-2-ylbutanoyl)piperidine-3-carboxamide |
| InChIKey | AGHXEEQYYLOXNF-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)CCC(=O)C2=CC=CS2)C(=O)N |
Computed by PubChem (NCBI)