CAS 1213989-74-2 is the registry number for 2-(4-(acetylamino)phenyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg.
2-(4-acetamidophenyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid (CAS 1213989-74-2) is a chemical compound with the molecular formula C14H18N2O3S and a molecular weight of 294.37 g/mol. IUPAC name: 2-(4-acetamidophenyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid. InChIKey: OZDHNYPDYFMVKR-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O3S |
|---|---|
| Molecular weight | 294.37 g/mol |
| IUPAC name | 2-(4-acetamidophenyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | OZDHNYPDYFMVKR-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)C2NC(C(S2)(C)C)C(=O)O |
Computed by PubChem (NCBI)