CAS 91944-64-8 appears in our catalog under these names: N,N–Dimethylpyridin–4–amine 4–methylbenzenesulfonate, N, N-Dimethylpyridin-4-amine 4-methylbenzenesulfonate, N,N-Dimethylpyridin-4-amine 4-methylbenzenesulfonate 95%, N,N-Dimethylpyridin-4-amine 4-methylbenzenesulfonate, 95%, 95%, N,N-Dimethylpyridin-4-amine 4-methylbenzenesulfonate, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 2g, 1g, 100mg, 250mg, 10g, 100g.
N,N-dimethylpyridin-4-amine;4-methylbenzenesulfonic acid (CAS 91944-64-8) is a chemical compound with the molecular formula C14H18N2O3S and a molecular weight of 294.37 g/mol. IUPAC name: N,N-dimethylpyridin-4-amine;4-methylbenzenesulfonic acid. InChIKey: OAOSXODRWGDDCV-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O3S |
|---|---|
| Molecular weight | 294.37 g/mol |
| IUPAC name | N,N-dimethylpyridin-4-amine;4-methylbenzenesulfonic acid |
| InChIKey | OAOSXODRWGDDCV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CN(C)C1=CC=NC=C1 |
Computed by PubChem (NCBI)