CAS 1096987-61-9 appears in our catalog under these names: 5-(4-Chlorobenzoyl)-2H-1,3-benzodioxole, 95%, 5-(4-Chlorobenzoyl)-1,3-dioxaindane. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
1,3-benzodioxol-5-yl-(4-chlorophenyl)methanone (CAS 1096987-61-9) is a chemical compound with the molecular formula C14H9ClO3 and a molecular weight of 260.67 g/mol. IUPAC name: 1,3-benzodioxol-5-yl-(4-chlorophenyl)methanone. InChIKey: RLBFWLQJDHOFNP-UHFFFAOYSA-N.
| Molecular formula | C14H9ClO3 |
|---|---|
| Molecular weight | 260.67 g/mol |
| IUPAC name | 1,3-benzodioxol-5-yl-(4-chlorophenyl)methanone |
| InChIKey | RLBFWLQJDHOFNP-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C(=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)