Products 1261921-72-5
CAS 1261921-72-5 appears in our catalog under these names: 4-Chloro-3-(4-formylphenyl)benzoic acid, 95%, 4-Chloro-3-(4-formylphenyl)benzoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
4-chloro-3-(4-formylphenyl)benzoic acid (CAS 1261921-72-5) is a chemical compound with the molecular formula C14H9ClO3 and a molecular weight of 260.67 g/mol. IUPAC name: 4-chloro-3-(4-formylphenyl)benzoic acid. InChIKey: XFSNYZOUSWRPPL-UHFFFAOYSA-N.
| Molecular formula | C14H9ClO3 |
|---|---|
| Molecular weight | 260.67 g/mol |
| IUPAC name | 4-chloro-3-(4-formylphenyl)benzoic acid |
| InChIKey | XFSNYZOUSWRPPL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=C(C=CC(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)