Products 1261983-94-1

CAS 1261983-94-1 is the registry number for 2-Chloro-5-(3-formylphenyl)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

2-chloro-5-(3-formylphenyl)benzoic acid (CAS 1261983-94-1) is a chemical compound with the molecular formula C14H9ClO3 and a molecular weight of 260.67 g/mol. IUPAC name: 2-chloro-5-(3-formylphenyl)benzoic acid. InChIKey: IADQEJMDRPXFOK-UHFFFAOYSA-N.

Identity
Molecular formulaC14H9ClO3
Molecular weight260.67 g/mol
IUPAC name2-chloro-5-(3-formylphenyl)benzoic acid
InChIKeyIADQEJMDRPXFOK-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C2=CC(=C(C=C2)Cl)C(=O)O)C=O

Computed by PubChem (NCBI)