CAS 444286-64-0 is the registry number for 3-Formylphenyl 2-chlorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(3-formylphenyl) 2-chlorobenzoate (CAS 444286-64-0) is a chemical compound with the molecular formula C14H9ClO3 and a molecular weight of 260.67 g/mol. IUPAC name: (3-formylphenyl) 2-chlorobenzoate. InChIKey: ZRBMRVWMDNRGBH-UHFFFAOYSA-N.
| Molecular formula | C14H9ClO3 |
|---|---|
| Molecular weight | 260.67 g/mol |
| IUPAC name | (3-formylphenyl) 2-chlorobenzoate |
| InChIKey | ZRBMRVWMDNRGBH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)OC2=CC=CC(=C2)C=O)Cl |
Computed by PubChem (NCBI)