CAS 5543-24-8 is the registry number for 2-(2-Chlorobenzoyl)benzoic Acid. Offered by: TRC, Biosynth. Available pack sizes: 2,5g, 5000mg.
2-(2-chlorobenzoyl)benzoic acid (CAS 5543-24-8) is a chemical compound with the molecular formula C14H9ClO3 and a molecular weight of 260.67 g/mol. IUPAC name: 2-(2-chlorobenzoyl)benzoic acid. InChIKey: YTSWAXSUNMFKBE-UHFFFAOYSA-N.
| Molecular formula | C14H9ClO3 |
|---|---|
| Molecular weight | 260.67 g/mol |
| IUPAC name | 2-(2-chlorobenzoyl)benzoic acid |
| InChIKey | YTSWAXSUNMFKBE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=CC=C2Cl)C(=O)O |
Computed by PubChem (NCBI)