CAS 85-56-3 appears in our catalog under these names: 2-(4’-Chlorobenzoyl)benzoic Acid, >95% (HPLC), 2–(4–Chlorobenzoyl)benzoic acid, 4'-Chlorobenzophenone-2-carboxylic Acid, >98.0%(GC)(T), 2-(4-Chlorobenzoyl)benzoic acid 98%, 2-(4-CHLOROBENZOYL)BENZOIC ACID, 98%. Offered by: TRC, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 10g, 1g, 50g, 500g, 25g, 100g, 1000g, 1kg.
2-(4-chlorobenzoyl)benzoic acid (CAS 85-56-3) is a chemical compound with the molecular formula C14H9ClO3 and a molecular weight of 260.67 g/mol. IUPAC name: 2-(4-chlorobenzoyl)benzoic acid. InChIKey: YWECCEXWKFHHQJ-UHFFFAOYSA-N.
| Molecular formula | C14H9ClO3 |
|---|---|
| Molecular weight | 260.67 g/mol |
| IUPAC name | 2-(4-chlorobenzoyl)benzoic acid |
| InChIKey | YWECCEXWKFHHQJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)